C7H2BrF6N — CID 131530790
4-bromo-3,5-bis(trifluoromethyl)pyridine (PubChem CID 131530790) has the molecular formula C7H2BrF6N and a molecular weight of 293.99 g/mol. Its IUPAC name is 4-bromo-3,5-bis(trifluoromethyl)pyridine.
| Compound Name | 4-bromo-3,5-bis(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 131530790 |
| Molecular Formula | C7H2BrF6N |
| Molecular Weight | 293.99 g/mol |
| Exact Mass | 292.93 |
| IUPAC Name | 4-bromo-3,5-bis(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1cncc(C(F)(F)F)c1Br |
| InChI | InChI=1S/C7H2BrF6N/c8-5-3(6(9,10)11)1-15-2-4(5)7(12,13)14/h1-2H |
| InChIKey | RYSQUWOHPWYJDP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.99 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |