About 1-carbamimidoyl-2,3-dihydropyrrole-5-carboxylic acid
1-carbamimidoyl-2,3-dihydropyrrole-5-carboxylic acid (PubChem CID 13154359) has the molecular formula C6H9N3O2
and a molecular weight of 155.16 g/mol. Its IUPAC name is 1-carbamimidoyl-2,3-dihydropyrrole-5-carboxylic acid.
Molecular Properties
| Compound Name | 1-carbamimidoyl-2,3-dihydropyrrole-5-carboxylic acid |
| PubChem CID | 13154359 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | 1-carbamimidoyl-2,3-dihydropyrrole-5-carboxylic acid |
| SMILES | [H]/N=C(\N)N1CCC=C1C(=O)O |
| InChI | InChI=1S/C6H9N3O2/c7-6(8)9-3-1-2-4(9)5(10)11/h2H,1,3H2,(H3,7,8)(H,10,11) |
| InChIKey | HQGXYSTUNITHRW-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-carbamimidoyl-2,3-dihydropyrrole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-carbamimidoyl-2,3-dihydropyrrole-5-carboxylic acid?
The IUPAC name of 1-carbamimidoyl-2,3-dihydropyrrole-5-carboxylic acid (CID 13154359) is 1-carbamimidoyl-2,3-dihydropyrrole-5-carboxylic acid.
What is the SMILES notation for 1-carbamimidoyl-2,3-dihydropyrrole-5-carboxylic acid?
The canonical SMILES for 1-carbamimidoyl-2,3-dihydropyrrole-5-carboxylic acid is [H]/N=C(\N)N1CCC=C1C(=O)O.
What is the InChIKey of 1-carbamimidoyl-2,3-dihydropyrrole-5-carboxylic acid?
The InChIKey is HQGXYSTUNITHRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O2/c7-6(8)9-3-1-2-4(9)5(10)11/h2H,1,3H2,(H3,7,8)(H,10,11).
What are the key properties of 1-carbamimidoyl-2,3-dihydropyrrole-5-carboxylic acid?
1-carbamimidoyl-2,3-dihydropyrrole-5-carboxylic acid has a molecular weight of 155.16 g/mol, XLogP of -0.45, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-carbamimidoyl-2,3-dihydropyrrole-5-carboxylic acid is sourced from PubChem (CID 13154359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).