C7H6BrN3O — CID 131544412
5-bromo-3-methoxy-7H-pyrrolo[2,3-c]pyridazine (PubChem CID 131544412) has the molecular formula C7H6BrN3O and a molecular weight of 228.05 g/mol. Its IUPAC name is 5-bromo-3-methoxy-7H-pyrrolo[2,3-c]pyridazine.
| Compound Name | 5-bromo-3-methoxy-7H-pyrrolo[2,3-c]pyridazine |
|---|---|
| PubChem CID | 131544412 |
| Molecular Formula | C7H6BrN3O |
| Molecular Weight | 228.05 g/mol |
| Exact Mass | 226.97 |
| IUPAC Name | 5-bromo-3-methoxy-7H-pyrrolo[2,3-c]pyridazine |
| SMILES | COc1cc2c(Br)c[nH]c2nn1 |
| InChI | InChI=1S/C7H6BrN3O/c1-12-6-2-4-5(8)3-9-7(4)11-10-6/h2-3H,1H3,(H,9,11) |
| InChIKey | MXSIZDISGHSTQV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.05 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |