C23H29N3O4 — CID 13157412
1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[4-(5-methyl-1H-imidazol-2-yl)phenoxy]propan-2-ol (PubChem CID 13157412) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[4-(5-methyl-1H-imidazol-2-yl)phenoxy]propan-2-ol.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[4-(5-methyl-1H-imidazol-2-yl)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 13157412 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[4-(5-methyl-1H-imidazol-2-yl)phenoxy]propan-2-ol |
| SMILES | COc1ccc(CCNCC(O)COc2ccc(-c3ncc(C)[nH]3)cc2)cc1OC |
| InChI | InChI=1S/C23H29N3O4/c1-16-13-25-23(26-16)18-5-7-20(8-6-18)30-15-19(27)14-24-11-10-17-4-9-21(28-2)22(12-17)29-3/h4-9,12-13,19,24,27H,10-11,14-15H2,1-3H3,(H,25,26) |
| InChIKey | IUFUTNJTGYHQHZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 88.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|