C8H4BrF2NO3 — CID 131580407
2-bromo-1-(3,6-difluoro-2-nitrophenyl)ethanone (PubChem CID 131580407) has the molecular formula C8H4BrF2NO3 and a molecular weight of 280.02 g/mol. Its IUPAC name is 2-bromo-1-(3,6-difluoro-2-nitrophenyl)ethanone.
| Compound Name | 2-bromo-1-(3,6-difluoro-2-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 131580407 |
| Molecular Formula | C8H4BrF2NO3 |
| Molecular Weight | 280.02 g/mol |
| Exact Mass | 278.93 |
| IUPAC Name | 2-bromo-1-(3,6-difluoro-2-nitrophenyl)ethanone |
| SMILES | O=C(CBr)c1c(F)ccc(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H4BrF2NO3/c9-3-6(13)7-4(10)1-2-5(11)8(7)12(14)15/h1-2H,3H2 |
| InChIKey | JNUJSJKPDGRWRV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.02 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|