C8H8BrFN2O — CID 171025263
2-bromo-1-(2,3-diamino-6-fluorophenyl)ethanone (PubChem CID 171025263) has the molecular formula C8H8BrFN2O and a molecular weight of 247.07 g/mol. Its IUPAC name is 2-bromo-1-(2,3-diamino-6-fluorophenyl)ethanone.
| Compound Name | 2-bromo-1-(2,3-diamino-6-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 171025263 |
| Molecular Formula | C8H8BrFN2O |
| Molecular Weight | 247.07 g/mol |
| Exact Mass | 245.98 |
| IUPAC Name | 2-bromo-1-(2,3-diamino-6-fluorophenyl)ethanone |
| SMILES | Nc1ccc(F)c(C(=O)CBr)c1N |
| InChI | InChI=1S/C8H8BrFN2O/c9-3-6(13)7-4(10)1-2-5(11)8(7)12/h1-2H,3,11-12H2 |
| InChIKey | WXEJJEXWCVVDAH-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.07 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|