C9H11BrN2O — CID 171013874
2-bromo-1-(2,3-diamino-6-methylphenyl)ethanone (PubChem CID 171013874) has the molecular formula C9H11BrN2O and a molecular weight of 243.10 g/mol. Its IUPAC name is 2-bromo-1-(2,3-diamino-6-methylphenyl)ethanone.
| Compound Name | 2-bromo-1-(2,3-diamino-6-methylphenyl)ethanone |
|---|---|
| PubChem CID | 171013874 |
| Molecular Formula | C9H11BrN2O |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | 2-bromo-1-(2,3-diamino-6-methylphenyl)ethanone |
| SMILES | Cc1ccc(N)c(N)c1C(=O)CBr |
| InChI | InChI=1S/C9H11BrN2O/c1-5-2-3-6(11)9(12)8(5)7(13)4-10/h2-3H,4,11-12H2,1H3 |
| InChIKey | LDXBGHGJOYYFBP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|