C11H21NO3 — CID 13161379
2,2,2-tri(propan-2-yloxy)acetonitrile (PubChem CID 13161379) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is 2,2,2-tri(propan-2-yloxy)acetonitrile.
| Compound Name | 2,2,2-tri(propan-2-yloxy)acetonitrile |
|---|---|
| PubChem CID | 13161379 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 2,2,2-tri(propan-2-yloxy)acetonitrile |
| SMILES | CC(C)OC(C#N)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C11H21NO3/c1-8(2)13-11(7-12,14-9(3)4)15-10(5)6/h8-10H,1-6H3 |
| InChIKey | GMYJKKMTTQISKX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|