C11H22AlNO3 — CID 174386789
alumane;3-oxo-2,2-di(propan-2-yloxy)pentanenitrile (PubChem CID 174386789) has the molecular formula C11H22AlNO3 and a molecular weight of 243.28 g/mol. Its IUPAC name is alumane;3-oxo-2,2-di(propan-2-yloxy)pentanenitrile.
| Compound Name | alumane;3-oxo-2,2-di(propan-2-yloxy)pentanenitrile |
|---|---|
| PubChem CID | 174386789 |
| Molecular Formula | C11H22AlNO3 |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | alumane;3-oxo-2,2-di(propan-2-yloxy)pentanenitrile |
| SMILES | CCC(=O)C(C#N)(OC(C)C)OC(C)C.[AlH3] |
| InChI | InChI=1S/C11H19NO3.Al.3H/c1-6-10(13)11(7-12,14-8(2)3)15-9(4)5;;;;/h8-9H,6H2,1-5H3;;;; |
| InChIKey | SNJNYHOEQGGJMQ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|