About 2-cyano-3-oxopentanamide
2-cyano-3-oxopentanamide (PubChem CID 174475780) has the molecular formula C6H8N2O2
and a molecular weight of 140.14 g/mol. Its IUPAC name is 2-cyano-3-oxopentanamide.
Molecular Properties
| Compound Name | 2-cyano-3-oxopentanamide |
| PubChem CID | 174475780 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 2-cyano-3-oxopentanamide |
| SMILES | CCC(=O)C(C#N)C(N)=O |
| InChI | InChI=1S/C6H8N2O2/c1-2-5(9)4(3-7)6(8)10/h4H,2H2,1H3,(H2,8,10) |
| InChIKey | IIKJJHOKVCLARF-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 83.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-cyano-3-oxopentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-3-oxopentanamide?
The IUPAC name of 2-cyano-3-oxopentanamide (CID 174475780) is 2-cyano-3-oxopentanamide.
What is the SMILES notation for 2-cyano-3-oxopentanamide?
The canonical SMILES for 2-cyano-3-oxopentanamide is CCC(=O)C(C#N)C(N)=O.
What is the InChIKey of 2-cyano-3-oxopentanamide?
The InChIKey is IIKJJHOKVCLARF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2/c1-2-5(9)4(3-7)6(8)10/h4H,2H2,1H3,(H2,8,10).
What are the key properties of 2-cyano-3-oxopentanamide?
2-cyano-3-oxopentanamide has a molecular weight of 140.14 g/mol, XLogP of -0.41, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-3-oxopentanamide is sourced from PubChem (CID 174475780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).