C23H21F3N4O2 — CID 131636390
5-[(6R)-1-(2,6-dimethyl-4-pyridinyl)-6-methyl-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepin-3-yl]-2-(trifluoromethoxy)benzonitrile (PubChem CID 131636390) has the molecular formula C23H21F3N4O2 and a molecular weight of 442.44 g/mol. Its IUPAC name is 5-[(6R)-1-(2,6-dimethyl-4-pyridinyl)-6-methyl-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepin-3-yl]-2-(trifluoromethoxy)benzonitrile.
| Compound Name | 5-[(6R)-1-(2,6-dimethyl-4-pyridinyl)-6-methyl-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepin-3-yl]-2-(trifluoromethoxy)benzonitrile |
|---|---|
| PubChem CID | 131636390 |
| Molecular Formula | C23H21F3N4O2 |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 5-[(6R)-1-(2,6-dimethyl-4-pyridinyl)-6-methyl-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepin-3-yl]-2-(trifluoromethoxy)benzonitrile |
| SMILES | Cc1cc(-c2nc(-c3ccc(OC(F)(F)F)c(C#N)c3)n3c2CCO[C@H](C)C3)cc(C)n1 |
| InChI | InChI=1S/C23H21F3N4O2/c1-13-8-17(9-14(2)28-13)21-19-6-7-31-15(3)12-30(19)22(29-21)16-4-5-20(18(10-16)11-27)32-23(24,25)26/h4-5,8-10,15H,6-7,12H2,1-3H3/t15-/m1/s1 |
| InChIKey | XUGJYLHBJYVXSW-OAHLLOKOSA-N |
| XLogP | 4.96 |
| TPSA | 72.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |