C14H22N2O3S — CID 131639239
9-(furan-2-ylmethyl)-1-methylsulfonyl-1,9-diazaspiro[4.5]decane (PubChem CID 131639239) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is 9-(furan-2-ylmethyl)-1-methylsulfonyl-1,9-diazaspiro[4.5]decane.
| Compound Name | 9-(furan-2-ylmethyl)-1-methylsulfonyl-1,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 131639239 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 9-(furan-2-ylmethyl)-1-methylsulfonyl-1,9-diazaspiro[4.5]decane |
| SMILES | CS(=O)(=O)N1CCCC12CCCN(Cc1ccco1)C2 |
| InChI | InChI=1S/C14H22N2O3S/c1-20(17,18)16-9-4-7-14(16)6-3-8-15(12-14)11-13-5-2-10-19-13/h2,5,10H,3-4,6-9,11-12H2,1H3 |
| InChIKey | FKTGYVBOURUORR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |