C19H24N2O3S — CID 97381136
(3aR,7aR)-6-(furan-2-ylmethyl)-1-methylsulfonyl-3a-phenyl-2,3,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridine (PubChem CID 97381136) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is (3aR,7aR)-6-(furan-2-ylmethyl)-1-methylsulfonyl-3a-phenyl-2,3,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridine.
| Compound Name | (3aR,7aR)-6-(furan-2-ylmethyl)-1-methylsulfonyl-3a-phenyl-2,3,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 97381136 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | (3aR,7aR)-6-(furan-2-ylmethyl)-1-methylsulfonyl-3a-phenyl-2,3,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridine |
| SMILES | CS(=O)(=O)N1CC[C@@]2(c3ccccc3)CCN(Cc3ccco3)C[C@H]12 |
| InChI | InChI=1S/C19H24N2O3S/c1-25(22,23)21-12-10-19(16-6-3-2-4-7-16)9-11-20(15-18(19)21)14-17-8-5-13-24-17/h2-8,13,18H,9-12,14-15H2,1H3/t18-,19+/m0/s1 |
| InChIKey | MXSHAYBCWDWOIG-RBUKOAKNSA-N |
| XLogP | 2.46 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |