C22H24N4O — CID 97404201
(3aS,7aR)-2-(furan-2-ylmethyl)-7a-phenyl-5-pyrimidin-2-yl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridine (PubChem CID 97404201) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is (3aS,7aR)-2-(furan-2-ylmethyl)-7a-phenyl-5-pyrimidin-2-yl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridine.
| Compound Name | (3aS,7aR)-2-(furan-2-ylmethyl)-7a-phenyl-5-pyrimidin-2-yl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 97404201 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | (3aS,7aR)-2-(furan-2-ylmethyl)-7a-phenyl-5-pyrimidin-2-yl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridine |
| SMILES | c1ccc([C@@]23CCN(c4ncccn4)C[C@@H]2CN(Cc2ccco2)C3)cc1 |
| InChI | InChI=1S/C22H24N4O/c1-2-6-18(7-3-1)22-9-12-26(21-23-10-5-11-24-21)15-19(22)14-25(17-22)16-20-8-4-13-27-20/h1-8,10-11,13,19H,9,12,14-17H2/t19-,22-/m0/s1 |
| InChIKey | BHOFFDZNVARFKO-UGKGYDQZSA-N |
| XLogP | 3.35 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |