C27H31BrN4 — CID 71174197
2-[3-[1-[(4-bromophenyl)methyl]piperidin-4-yl]-3-phenylpiperidin-1-yl]pyrimidine (PubChem CID 71174197) has the molecular formula C27H31BrN4 and a molecular weight of 491.48 g/mol. Its IUPAC name is 2-[3-[1-[(4-bromophenyl)methyl]piperidin-4-yl]-3-phenylpiperidin-1-yl]pyrimidine.
| Compound Name | 2-[3-[1-[(4-bromophenyl)methyl]piperidin-4-yl]-3-phenylpiperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 71174197 |
| Molecular Formula | C27H31BrN4 |
| Molecular Weight | 491.48 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 2-[3-[1-[(4-bromophenyl)methyl]piperidin-4-yl]-3-phenylpiperidin-1-yl]pyrimidine |
| SMILES | Brc1ccc(CN2CCC(C3(c4ccccc4)CCCN(c4ncccn4)C3)CC2)cc1 |
| InChI | InChI=1S/C27H31BrN4/c28-25-10-8-22(9-11-25)20-31-18-12-24(13-19-31)27(23-6-2-1-3-7-23)14-4-17-32(21-27)26-29-15-5-16-30-26/h1-3,5-11,15-16,24H,4,12-14,17-21H2 |
| InChIKey | HUOHEZFKTGGSOR-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.48 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |