C26H31BrN2O3 — CID 44580860
3-[1-[(4-bromophenyl)methyl]piperidin-4-yl]-1-(2-methoxyethyl)-3-phenylpiperidine-2,6-dione (PubChem CID 44580860) has the molecular formula C26H31BrN2O3 and a molecular weight of 499.45 g/mol. Its IUPAC name is 3-[1-[(4-bromophenyl)methyl]piperidin-4-yl]-1-(2-methoxyethyl)-3-phenylpiperidine-2,6-dione.
| Compound Name | 3-[1-[(4-bromophenyl)methyl]piperidin-4-yl]-1-(2-methoxyethyl)-3-phenylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 44580860 |
| Molecular Formula | C26H31BrN2O3 |
| Molecular Weight | 499.45 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 3-[1-[(4-bromophenyl)methyl]piperidin-4-yl]-1-(2-methoxyethyl)-3-phenylpiperidine-2,6-dione |
| SMILES | COCCN1C(=O)CCC(c2ccccc2)(C2CCN(Cc3ccc(Br)cc3)CC2)C1=O |
| InChI | InChI=1S/C26H31BrN2O3/c1-32-18-17-29-24(30)11-14-26(25(29)31,21-5-3-2-4-6-21)22-12-15-28(16-13-22)19-20-7-9-23(27)10-8-20/h2-10,22H,11-19H2,1H3 |
| InChIKey | BIKSUAIHZAPQMH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|