C26H33N3O4 — CID 26275267
(5R)-5-(1-benzylpiperidin-4-yl)-3-(2-methoxyethyl)-5-[(3-methoxyphenyl)methyl]imidazolidine-2,4-dione (PubChem CID 26275267) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is (5R)-5-(1-benzylpiperidin-4-yl)-3-(2-methoxyethyl)-5-[(3-methoxyphenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-(1-benzylpiperidin-4-yl)-3-(2-methoxyethyl)-5-[(3-methoxyphenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 26275267 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | (5R)-5-(1-benzylpiperidin-4-yl)-3-(2-methoxyethyl)-5-[(3-methoxyphenyl)methyl]imidazolidine-2,4-dione |
| SMILES | COCCN1C(=O)N[C@](Cc2cccc(OC)c2)(C2CCN(Cc3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C26H33N3O4/c1-32-16-15-29-24(30)26(27-25(29)31,18-21-9-6-10-23(17-21)33-2)22-11-13-28(14-12-22)19-20-7-4-3-5-8-20/h3-10,17,22H,11-16,18-19H2,1-2H3,(H,27,31)/t26-/m1/s1 |
| InChIKey | NOOJLPAVNBRTCY-AREMUKBSSA-N |
| XLogP | 3.09 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|