C19H27N3O4 — CID 95210352
(5R)-3-(3-hydroxypropyl)-5-[(3-methoxyphenyl)methyl]-5-piperidin-4-ylimidazolidine-2,4-dione (PubChem CID 95210352) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is (5R)-3-(3-hydroxypropyl)-5-[(3-methoxyphenyl)methyl]-5-piperidin-4-ylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-(3-hydroxypropyl)-5-[(3-methoxyphenyl)methyl]-5-piperidin-4-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95210352 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | (5R)-3-(3-hydroxypropyl)-5-[(3-methoxyphenyl)methyl]-5-piperidin-4-ylimidazolidine-2,4-dione |
| SMILES | COc1cccc(C[C@]2(C3CCNCC3)NC(=O)N(CCCO)C2=O)c1 |
| InChI | InChI=1S/C19H27N3O4/c1-26-16-5-2-4-14(12-16)13-19(15-6-8-20-9-7-15)17(24)22(10-3-11-23)18(25)21-19/h2,4-5,12,15,20,23H,3,6-11,13H2,1H3,(H,21,25)/t19-/m1/s1 |
| InChIKey | NMPVFQCUEDQFGP-LJQANCHMSA-N |
| XLogP | 0.91 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|