C21H29N3O3 — CID 95222574
(5R)-5-[(3-methoxyphenyl)methyl]-5-[1-[(E)-2-methylbut-2-enyl]piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 95222574) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is (5R)-5-[(3-methoxyphenyl)methyl]-5-[1-[(E)-2-methylbut-2-enyl]piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(3-methoxyphenyl)methyl]-5-[1-[(E)-2-methylbut-2-enyl]piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95222574 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | (5R)-5-[(3-methoxyphenyl)methyl]-5-[1-[(E)-2-methylbut-2-enyl]piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | C/C=C(\C)CN1CCC([C@@]2(Cc3cccc(OC)c3)NC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C21H29N3O3/c1-4-15(2)14-24-10-8-17(9-11-24)21(19(25)22-20(26)23-21)13-16-6-5-7-18(12-16)27-3/h4-7,12,17H,8-11,13-14H2,1-3H3,(H2,22,23,25,26)/b15-4+/t21-/m1/s1 |
| InChIKey | NMOOORDYFWPXNJ-LTVHSIDISA-N |
| XLogP | 2.49 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|