C15H18FN3O2 — CID 95221329
(5R)-5-[(3-fluorophenyl)methyl]-5-piperidin-4-ylimidazolidine-2,4-dione (PubChem CID 95221329) has the molecular formula C15H18FN3O2 and a molecular weight of 291.33 g/mol. Its IUPAC name is (5R)-5-[(3-fluorophenyl)methyl]-5-piperidin-4-ylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(3-fluorophenyl)methyl]-5-piperidin-4-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95221329 |
| Molecular Formula | C15H18FN3O2 |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | (5R)-5-[(3-fluorophenyl)methyl]-5-piperidin-4-ylimidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@@](Cc2cccc(F)c2)(C2CCNCC2)N1 |
| InChI | InChI=1S/C15H18FN3O2/c16-12-3-1-2-10(8-12)9-15(11-4-6-17-7-5-11)13(20)18-14(21)19-15/h1-3,8,11,17H,4-7,9H2,(H2,18,19,20,21)/t15-/m1/s1 |
| InChIKey | ZZAZDGLWQGBVGB-OAHLLOKOSA-N |
| XLogP | 0.95 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|