C23H25F2N3O2 — CID 45188706
5-[1-[(3,5-difluorophenyl)methyl]piperidin-4-yl]-5-(2-phenylethyl)imidazolidine-2,4-dione (PubChem CID 45188706) has the molecular formula C23H25F2N3O2 and a molecular weight of 413.47 g/mol. Its IUPAC name is 5-[1-[(3,5-difluorophenyl)methyl]piperidin-4-yl]-5-(2-phenylethyl)imidazolidine-2,4-dione.
| Compound Name | 5-[1-[(3,5-difluorophenyl)methyl]piperidin-4-yl]-5-(2-phenylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45188706 |
| Molecular Formula | C23H25F2N3O2 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 5-[1-[(3,5-difluorophenyl)methyl]piperidin-4-yl]-5-(2-phenylethyl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(CCc2ccccc2)(C2CCN(Cc3cc(F)cc(F)c3)CC2)N1 |
| InChI | InChI=1S/C23H25F2N3O2/c24-19-12-17(13-20(25)14-19)15-28-10-7-18(8-11-28)23(21(29)26-22(30)27-23)9-6-16-4-2-1-3-5-16/h1-5,12-14,18H,6-11,15H2,(H2,26,27,29,30) |
| InChIKey | TZWSDKROEFBHHF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|