C25H31N3O2 — CID 45195590
5-[1-[(4-ethylphenyl)methyl]piperidin-4-yl]-5-(2-phenylethyl)imidazolidine-2,4-dione (PubChem CID 45195590) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is 5-[1-[(4-ethylphenyl)methyl]piperidin-4-yl]-5-(2-phenylethyl)imidazolidine-2,4-dione.
| Compound Name | 5-[1-[(4-ethylphenyl)methyl]piperidin-4-yl]-5-(2-phenylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45195590 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 5-[1-[(4-ethylphenyl)methyl]piperidin-4-yl]-5-(2-phenylethyl)imidazolidine-2,4-dione |
| SMILES | CCc1ccc(CN2CCC(C3(CCc4ccccc4)NC(=O)NC3=O)CC2)cc1 |
| InChI | InChI=1S/C25H31N3O2/c1-2-19-8-10-21(11-9-19)18-28-16-13-22(14-17-28)25(23(29)26-24(30)27-25)15-12-20-6-4-3-5-7-20/h3-11,22H,2,12-18H2,1H3,(H2,26,27,29,30) |
| InChIKey | ZQVCAKGAJFDZNQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|