C27H33N3O3 — CID 42168111
(5S)-5-(3-phenylpropyl)-5-[1-[(2-prop-2-enoxyphenyl)methyl]piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 42168111) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is (5S)-5-(3-phenylpropyl)-5-[1-[(2-prop-2-enoxyphenyl)methyl]piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-(3-phenylpropyl)-5-[1-[(2-prop-2-enoxyphenyl)methyl]piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42168111 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | (5S)-5-(3-phenylpropyl)-5-[1-[(2-prop-2-enoxyphenyl)methyl]piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | C=CCOc1ccccc1CN1CCC([C@]2(CCCc3ccccc3)NC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C27H33N3O3/c1-2-19-33-24-13-7-6-12-22(24)20-30-17-14-23(15-18-30)27(25(31)28-26(32)29-27)16-8-11-21-9-4-3-5-10-21/h2-7,9-10,12-13,23H,1,8,11,14-20H2,(H2,28,29,31,32)/t27-/m0/s1 |
| InChIKey | PISWRTOHXLCINM-MHZLTWQESA-N |
| XLogP | 4.06 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|