C25H31N3O4 — CID 45187933
5-[1-[(3-hydroxy-4-methoxyphenyl)methyl]piperidin-4-yl]-5-(3-phenylpropyl)imidazolidine-2,4-dione (PubChem CID 45187933) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is 5-[1-[(3-hydroxy-4-methoxyphenyl)methyl]piperidin-4-yl]-5-(3-phenylpropyl)imidazolidine-2,4-dione.
| Compound Name | 5-[1-[(3-hydroxy-4-methoxyphenyl)methyl]piperidin-4-yl]-5-(3-phenylpropyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45187933 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 5-[1-[(3-hydroxy-4-methoxyphenyl)methyl]piperidin-4-yl]-5-(3-phenylpropyl)imidazolidine-2,4-dione |
| SMILES | COc1ccc(CN2CCC(C3(CCCc4ccccc4)NC(=O)NC3=O)CC2)cc1O |
| InChI | InChI=1S/C25H31N3O4/c1-32-22-10-9-19(16-21(22)29)17-28-14-11-20(12-15-28)25(23(30)26-24(31)27-25)13-5-8-18-6-3-2-4-7-18/h2-4,6-7,9-10,16,20,29H,5,8,11-15,17H2,1H3,(H2,26,27,30,31) |
| InChIKey | XQGYKRFTMAJDDC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|