C26H33N3O4 — CID 42325367
(5R)-5-[1-[(2,3-dimethoxyphenyl)methyl]piperidin-4-yl]-5-(3-phenylpropyl)imidazolidine-2,4-dione (PubChem CID 42325367) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is (5R)-5-[1-[(2,3-dimethoxyphenyl)methyl]piperidin-4-yl]-5-(3-phenylpropyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[1-[(2,3-dimethoxyphenyl)methyl]piperidin-4-yl]-5-(3-phenylpropyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42325367 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | (5R)-5-[1-[(2,3-dimethoxyphenyl)methyl]piperidin-4-yl]-5-(3-phenylpropyl)imidazolidine-2,4-dione |
| SMILES | COc1cccc(CN2CCC([C@@]3(CCCc4ccccc4)NC(=O)NC3=O)CC2)c1OC |
| InChI | InChI=1S/C26H33N3O4/c1-32-22-12-6-11-20(23(22)33-2)18-29-16-13-21(14-17-29)26(24(30)27-25(31)28-26)15-7-10-19-8-4-3-5-9-19/h3-6,8-9,11-12,21H,7,10,13-18H2,1-2H3,(H2,27,28,30,31)/t26-/m1/s1 |
| InChIKey | YJVVRNRMBXSJQB-AREMUKBSSA-N |
| XLogP | 3.52 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|