C27H30N4O2 — CID 42170913
(5R)-5-(3-phenylpropyl)-5-[1-(quinolin-7-ylmethyl)piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 42170913) has the molecular formula C27H30N4O2 and a molecular weight of 442.56 g/mol. Its IUPAC name is (5R)-5-(3-phenylpropyl)-5-[1-(quinolin-7-ylmethyl)piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-(3-phenylpropyl)-5-[1-(quinolin-7-ylmethyl)piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42170913 |
| Molecular Formula | C27H30N4O2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | (5R)-5-(3-phenylpropyl)-5-[1-(quinolin-7-ylmethyl)piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@@](CCCc2ccccc2)(C2CCN(Cc3ccc4cccnc4c3)CC2)N1 |
| InChI | InChI=1S/C27H30N4O2/c32-25-27(30-26(33)29-25,14-4-8-20-6-2-1-3-7-20)23-12-16-31(17-13-23)19-21-10-11-22-9-5-15-28-24(22)18-21/h1-3,5-7,9-11,15,18,23H,4,8,12-14,16-17,19H2,(H2,29,30,32,33)/t27-/m1/s1 |
| InChIKey | WTJGCCPFVLPQDF-HHHXNRCGSA-N |
| XLogP | 4.05 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|