C25H26N4O2 — CID 45181974
5-benzyl-5-[1-(quinolin-6-ylmethyl)piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 45181974) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is 5-benzyl-5-[1-(quinolin-6-ylmethyl)piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | 5-benzyl-5-[1-(quinolin-6-ylmethyl)piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45181974 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 5-benzyl-5-[1-(quinolin-6-ylmethyl)piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cc2ccccc2)(C2CCN(Cc3ccc4ncccc4c3)CC2)N1 |
| InChI | InChI=1S/C25H26N4O2/c30-23-25(28-24(31)27-23,16-18-5-2-1-3-6-18)21-10-13-29(14-11-21)17-19-8-9-22-20(15-19)7-4-12-26-22/h1-9,12,15,21H,10-11,13-14,16-17H2,(H2,27,28,30,31) |
| InChIKey | CWORMCUXWPPSQT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|