C25H29N3O3 — CID 45186410
5-benzyl-5-[1-[(E)-3-(2-methoxyphenyl)prop-2-enyl]piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 45186410) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is 5-benzyl-5-[1-[(E)-3-(2-methoxyphenyl)prop-2-enyl]piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | 5-benzyl-5-[1-[(E)-3-(2-methoxyphenyl)prop-2-enyl]piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45186410 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 5-benzyl-5-[1-[(E)-3-(2-methoxyphenyl)prop-2-enyl]piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | COc1ccccc1/C=C/CN1CCC(C2(Cc3ccccc3)NC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C25H29N3O3/c1-31-22-12-6-5-10-20(22)11-7-15-28-16-13-21(14-17-28)25(23(29)26-24(30)27-25)18-19-8-3-2-4-9-19/h2-12,21H,13-18H2,1H3,(H2,26,27,29,30)/b11-7+ |
| InChIKey | JKMXWEURNBJGOW-YRNVUSSQSA-N |
| XLogP | 3.24 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|