C24H27ClFN3O2 — CID 42246930
(5S)-5-[1-[(2-chloro-6-fluorophenyl)methyl]piperidin-4-yl]-5-(3-phenylpropyl)imidazolidine-2,4-dione (PubChem CID 42246930) has the molecular formula C24H27ClFN3O2 and a molecular weight of 443.95 g/mol. Its IUPAC name is (5S)-5-[1-[(2-chloro-6-fluorophenyl)methyl]piperidin-4-yl]-5-(3-phenylpropyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[1-[(2-chloro-6-fluorophenyl)methyl]piperidin-4-yl]-5-(3-phenylpropyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42246930 |
| Molecular Formula | C24H27ClFN3O2 |
| Molecular Weight | 443.95 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | (5S)-5-[1-[(2-chloro-6-fluorophenyl)methyl]piperidin-4-yl]-5-(3-phenylpropyl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@](CCCc2ccccc2)(C2CCN(Cc3c(F)cccc3Cl)CC2)N1 |
| InChI | InChI=1S/C24H27ClFN3O2/c25-20-9-4-10-21(26)19(20)16-29-14-11-18(12-15-29)24(22(30)27-23(31)28-24)13-5-8-17-6-2-1-3-7-17/h1-4,6-7,9-10,18H,5,8,11-16H2,(H2,27,28,30,31)/t24-/m0/s1 |
| InChIKey | QVRJCGSBCQHANF-DEOSSOPVSA-N |
| XLogP | 4.29 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.95 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|