C26H31N3O5 — CID 45193668
5-[1-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]piperidin-4-yl]-5-(3-phenylpropyl)imidazolidine-2,4-dione (PubChem CID 45193668) has the molecular formula C26H31N3O5 and a molecular weight of 465.55 g/mol. Its IUPAC name is 5-[1-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]piperidin-4-yl]-5-(3-phenylpropyl)imidazolidine-2,4-dione.
| Compound Name | 5-[1-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]piperidin-4-yl]-5-(3-phenylpropyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45193668 |
| Molecular Formula | C26H31N3O5 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 5-[1-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]piperidin-4-yl]-5-(3-phenylpropyl)imidazolidine-2,4-dione |
| SMILES | COc1cc(CN2CCC(C3(CCCc4ccccc4)NC(=O)NC3=O)CC2)cc2c1OCO2 |
| InChI | InChI=1S/C26H31N3O5/c1-32-21-14-19(15-22-23(21)34-17-33-22)16-29-12-9-20(10-13-29)26(24(30)27-25(31)28-26)11-5-8-18-6-3-2-4-7-18/h2-4,6-7,14-15,20H,5,8-13,16-17H2,1H3,(H2,27,28,30,31) |
| InChIKey | DKBCHWASVPEHJR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|