C21H31N3O2 — CID 42343993
(5R)-5-(3-methylbutyl)-5-[1-[(2-methylphenyl)methyl]piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 42343993) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is (5R)-5-(3-methylbutyl)-5-[1-[(2-methylphenyl)methyl]piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-(3-methylbutyl)-5-[1-[(2-methylphenyl)methyl]piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42343993 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | (5R)-5-(3-methylbutyl)-5-[1-[(2-methylphenyl)methyl]piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | Cc1ccccc1CN1CCC([C@@]2(CCC(C)C)NC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C21H31N3O2/c1-15(2)8-11-21(19(25)22-20(26)23-21)18-9-12-24(13-10-18)14-17-7-5-4-6-16(17)3/h4-7,15,18H,8-14H2,1-3H3,(H2,22,23,25,26)/t21-/m1/s1 |
| InChIKey | BXKOFUQYPNUWAP-OAQYLSRUSA-N |
| XLogP | 3.22 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|