C18H29N3O3 — CID 126463038
5-(3-methylbutyl)-5-(1-pent-4-enoylpiperidin-4-yl)imidazolidine-2,4-dione (PubChem CID 126463038) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is 5-(3-methylbutyl)-5-(1-pent-4-enoylpiperidin-4-yl)imidazolidine-2,4-dione.
| Compound Name | 5-(3-methylbutyl)-5-(1-pent-4-enoylpiperidin-4-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126463038 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | 5-(3-methylbutyl)-5-(1-pent-4-enoylpiperidin-4-yl)imidazolidine-2,4-dione |
| SMILES | C=CCCC(=O)N1CCC(C2(CCC(C)C)NC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C18H29N3O3/c1-4-5-6-15(22)21-11-8-14(9-12-21)18(10-7-13(2)3)16(23)19-17(24)20-18/h4,13-14H,1,5-12H2,2-3H3,(H2,19,20,23,24) |
| InChIKey | JCVXDGCMXOKASV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|