C21H27N3O3 — CID 164626807
5-cyclopropyl-5-[3-(4-methyl-4-phenylpiperidin-1-yl)-3-oxopropyl]imidazolidine-2,4-dione (PubChem CID 164626807) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is 5-cyclopropyl-5-[3-(4-methyl-4-phenylpiperidin-1-yl)-3-oxopropyl]imidazolidine-2,4-dione.
| Compound Name | 5-cyclopropyl-5-[3-(4-methyl-4-phenylpiperidin-1-yl)-3-oxopropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 164626807 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 5-cyclopropyl-5-[3-(4-methyl-4-phenylpiperidin-1-yl)-3-oxopropyl]imidazolidine-2,4-dione |
| SMILES | CC1(c2ccccc2)CCN(C(=O)CCC2(C3CC3)NC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C21H27N3O3/c1-20(15-5-3-2-4-6-15)11-13-24(14-12-20)17(25)9-10-21(16-7-8-16)18(26)22-19(27)23-21/h2-6,16H,7-14H2,1H3,(H2,22,23,26,27) |
| InChIKey | CXKLSQBNZASBCG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|