C18H27N3O3 — CID 145414351
5-methyl-5-[3-oxo-3-(4-phenylpiperidin-1-yl)propyl]imidazolidine-2,4-dione;molecular hydrogen (PubChem CID 145414351) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is 5-methyl-5-[3-oxo-3-(4-phenylpiperidin-1-yl)propyl]imidazolidine-2,4-dione;molecular hydrogen.
| Compound Name | 5-methyl-5-[3-oxo-3-(4-phenylpiperidin-1-yl)propyl]imidazolidine-2,4-dione;molecular hydrogen |
|---|---|
| PubChem CID | 145414351 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 5-methyl-5-[3-oxo-3-(4-phenylpiperidin-1-yl)propyl]imidazolidine-2,4-dione;molecular hydrogen |
| SMILES | CC1(CCC(=O)N2CCC(c3ccccc3)CC2)NC(=O)NC1=O.[H][H].[H][H] |
| InChI | InChI=1S/C18H23N3O3.2H2/c1-18(16(23)19-17(24)20-18)10-7-15(22)21-11-8-14(9-12-21)13-5-3-2-4-6-13;;/h2-6,14H,7-12H2,1H3,(H2,19,20,23,24);2*1H |
| InChIKey | WONDYMCFHAZODY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|