C20H31N3O3 — CID 145414348
(5R)-5-ethyl-5-[(2S)-2-methyl-3-oxo-3-(4-phenylpiperidin-1-yl)propyl]imidazolidine-2,4-dione;molecular hydrogen (PubChem CID 145414348) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is (5R)-5-ethyl-5-[(2S)-2-methyl-3-oxo-3-(4-phenylpiperidin-1-yl)propyl]imidazolidine-2,4-dione;molecular hydrogen.
| Compound Name | (5R)-5-ethyl-5-[(2S)-2-methyl-3-oxo-3-(4-phenylpiperidin-1-yl)propyl]imidazolidine-2,4-dione;molecular hydrogen |
|---|---|
| PubChem CID | 145414348 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | (5R)-5-ethyl-5-[(2S)-2-methyl-3-oxo-3-(4-phenylpiperidin-1-yl)propyl]imidazolidine-2,4-dione;molecular hydrogen |
| SMILES | CC[C@]1(C[C@H](C)C(=O)N2CCC(c3ccccc3)CC2)NC(=O)NC1=O.[H][H].[H][H] |
| InChI | InChI=1S/C20H27N3O3.2H2/c1-3-20(18(25)21-19(26)22-20)13-14(2)17(24)23-11-9-16(10-12-23)15-7-5-4-6-8-15;;/h4-8,14,16H,3,9-13H2,1-2H3,(H2,21,22,25,26);2*1H/t14-,20+;;/m0../s1 |
| InChIKey | DUPVWWWZGTZOML-AAKYCSGMSA-N |
| XLogP | 2.90 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|