C19H24FN3O4 — CID 92582884
(5R)-5-[3-[(3R)-3-[(2-fluorophenoxy)methyl]piperidin-1-yl]-3-oxopropyl]-5-methylimidazolidine-2,4-dione (PubChem CID 92582884) has the molecular formula C19H24FN3O4 and a molecular weight of 377.42 g/mol. Its IUPAC name is (5R)-5-[3-[(3R)-3-[(2-fluorophenoxy)methyl]piperidin-1-yl]-3-oxopropyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-[3-[(3R)-3-[(2-fluorophenoxy)methyl]piperidin-1-yl]-3-oxopropyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 92582884 |
| Molecular Formula | C19H24FN3O4 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | (5R)-5-[3-[(3R)-3-[(2-fluorophenoxy)methyl]piperidin-1-yl]-3-oxopropyl]-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@]1(CCC(=O)N2CCC[C@@H](COc3ccccc3F)C2)NC(=O)NC1=O |
| InChI | InChI=1S/C19H24FN3O4/c1-19(17(25)21-18(26)22-19)9-8-16(24)23-10-4-5-13(11-23)12-27-15-7-3-2-6-14(15)20/h2-3,6-7,13H,4-5,8-12H2,1H3,(H2,21,22,25,26)/t13-,19-/m1/s1 |
| InChIKey | BTVKOYITKRAWJV-BFUOFWGJSA-N |
| XLogP | 1.82 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|