C22H28ClN3O3 — CID 42210327
(5R)-5-[1-[(E)-3-(4-chlorophenyl)prop-2-enoyl]piperidin-4-yl]-5-(3-methylbutyl)imidazolidine-2,4-dione (PubChem CID 42210327) has the molecular formula C22H28ClN3O3 and a molecular weight of 417.94 g/mol. Its IUPAC name is (5R)-5-[1-[(E)-3-(4-chlorophenyl)prop-2-enoyl]piperidin-4-yl]-5-(3-methylbutyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[1-[(E)-3-(4-chlorophenyl)prop-2-enoyl]piperidin-4-yl]-5-(3-methylbutyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42210327 |
| Molecular Formula | C22H28ClN3O3 |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | (5R)-5-[1-[(E)-3-(4-chlorophenyl)prop-2-enoyl]piperidin-4-yl]-5-(3-methylbutyl)imidazolidine-2,4-dione |
| SMILES | CC(C)CC[C@]1(C2CCN(C(=O)/C=C/c3ccc(Cl)cc3)CC2)NC(=O)NC1=O |
| InChI | InChI=1S/C22H28ClN3O3/c1-15(2)9-12-22(20(28)24-21(29)25-22)17-10-13-26(14-11-17)19(27)8-5-16-3-6-18(23)7-4-16/h3-8,15,17H,9-14H2,1-2H3,(H2,24,25,28,29)/b8-5+/t22-/m1/s1 |
| InChIKey | NGUOOLNLNIBXKD-QNBZTBGESA-N |
| XLogP | 3.61 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|