C22H33N3O2 — CID 45183704
5-[1-[(2,5-dimethylphenyl)methyl]piperidin-4-yl]-5-(3-methylbutyl)imidazolidine-2,4-dione (PubChem CID 45183704) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 5-[1-[(2,5-dimethylphenyl)methyl]piperidin-4-yl]-5-(3-methylbutyl)imidazolidine-2,4-dione.
| Compound Name | 5-[1-[(2,5-dimethylphenyl)methyl]piperidin-4-yl]-5-(3-methylbutyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45183704 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | 5-[1-[(2,5-dimethylphenyl)methyl]piperidin-4-yl]-5-(3-methylbutyl)imidazolidine-2,4-dione |
| SMILES | Cc1ccc(C)c(CN2CCC(C3(CCC(C)C)NC(=O)NC3=O)CC2)c1 |
| InChI | InChI=1S/C22H33N3O2/c1-15(2)7-10-22(20(26)23-21(27)24-22)19-8-11-25(12-9-19)14-18-13-16(3)5-6-17(18)4/h5-6,13,15,19H,7-12,14H2,1-4H3,(H2,23,24,26,27) |
| InChIKey | MZRVSEQWAFMJLO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|