C21H28ClN3O3 — CID 42454799
(5S)-5-[1-[2-(3-chlorophenyl)acetyl]piperidin-4-yl]-5-(3-methylbutyl)imidazolidine-2,4-dione (PubChem CID 42454799) has the molecular formula C21H28ClN3O3 and a molecular weight of 405.93 g/mol. Its IUPAC name is (5S)-5-[1-[2-(3-chlorophenyl)acetyl]piperidin-4-yl]-5-(3-methylbutyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[1-[2-(3-chlorophenyl)acetyl]piperidin-4-yl]-5-(3-methylbutyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42454799 |
| Molecular Formula | C21H28ClN3O3 |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | (5S)-5-[1-[2-(3-chlorophenyl)acetyl]piperidin-4-yl]-5-(3-methylbutyl)imidazolidine-2,4-dione |
| SMILES | CC(C)CC[C@@]1(C2CCN(C(=O)Cc3cccc(Cl)c3)CC2)NC(=O)NC1=O |
| InChI | InChI=1S/C21H28ClN3O3/c1-14(2)6-9-21(19(27)23-20(28)24-21)16-7-10-25(11-8-16)18(26)13-15-4-3-5-17(22)12-15/h3-5,12,14,16H,6-11,13H2,1-2H3,(H2,23,24,27,28)/t21-/m0/s1 |
| InChIKey | QUUDAFYARCDFBH-NRFANRHFSA-N |
| XLogP | 3.14 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|