C24H30FN3O3 — CID 42192312
(5S)-5-[(2-fluorophenyl)methyl]-5-[1-[(3R)-3-(5-methylfuran-2-yl)butyl]piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 42192312) has the molecular formula C24H30FN3O3 and a molecular weight of 427.52 g/mol. Its IUPAC name is (5S)-5-[(2-fluorophenyl)methyl]-5-[1-[(3R)-3-(5-methylfuran-2-yl)butyl]piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[(2-fluorophenyl)methyl]-5-[1-[(3R)-3-(5-methylfuran-2-yl)butyl]piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42192312 |
| Molecular Formula | C24H30FN3O3 |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | (5S)-5-[(2-fluorophenyl)methyl]-5-[1-[(3R)-3-(5-methylfuran-2-yl)butyl]piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc([C@H](C)CCN2CCC([C@]3(Cc4ccccc4F)NC(=O)NC3=O)CC2)o1 |
| InChI | InChI=1S/C24H30FN3O3/c1-16(21-8-7-17(2)31-21)9-12-28-13-10-19(11-14-28)24(22(29)26-23(30)27-24)15-18-5-3-4-6-20(18)25/h3-8,16,19H,9-15H2,1-2H3,(H2,26,27,29,30)/t16-,24+/m1/s1 |
| InChIKey | AWGZMYJXGUQGEO-GYCJOSAFSA-N |
| XLogP | 3.75 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|