C25H28FN3O4 — CID 26277872
(5S)-5-[(2-fluorophenyl)methyl]-5-[1-[3-(3-methoxyphenyl)propanoyl]piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 26277872) has the molecular formula C25H28FN3O4 and a molecular weight of 453.51 g/mol. Its IUPAC name is (5S)-5-[(2-fluorophenyl)methyl]-5-[1-[3-(3-methoxyphenyl)propanoyl]piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[(2-fluorophenyl)methyl]-5-[1-[3-(3-methoxyphenyl)propanoyl]piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 26277872 |
| Molecular Formula | C25H28FN3O4 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | (5S)-5-[(2-fluorophenyl)methyl]-5-[1-[3-(3-methoxyphenyl)propanoyl]piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | COc1cccc(CCC(=O)N2CCC([C@]3(Cc4ccccc4F)NC(=O)NC3=O)CC2)c1 |
| InChI | InChI=1S/C25H28FN3O4/c1-33-20-7-4-5-17(15-20)9-10-22(30)29-13-11-19(12-14-29)25(23(31)27-24(32)28-25)16-18-6-2-3-8-21(18)26/h2-8,15,19H,9-14,16H2,1H3,(H2,27,28,31,32)/t25-/m0/s1 |
| InChIKey | QEMNGRKPPFSQOX-VWLOTQADSA-N |
| XLogP | 2.83 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|