C20H24ClN3O3 — CID 56854186
5-[(2-chlorophenyl)methyl]-5-[1-(2-cyclopropylacetyl)piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 56854186) has the molecular formula C20H24ClN3O3 and a molecular weight of 389.88 g/mol. Its IUPAC name is 5-[(2-chlorophenyl)methyl]-5-[1-(2-cyclopropylacetyl)piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | 5-[(2-chlorophenyl)methyl]-5-[1-(2-cyclopropylacetyl)piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 56854186 |
| Molecular Formula | C20H24ClN3O3 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 5-[(2-chlorophenyl)methyl]-5-[1-(2-cyclopropylacetyl)piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cc2ccccc2Cl)(C2CCN(C(=O)CC3CC3)CC2)N1 |
| InChI | InChI=1S/C20H24ClN3O3/c21-16-4-2-1-3-14(16)12-20(18(26)22-19(27)23-20)15-7-9-24(10-8-15)17(25)11-13-5-6-13/h1-4,13,15H,5-12H2,(H2,22,23,26,27) |
| InChIKey | ANQJPHFRLRLOJH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|