C24H32ClN3O2 — CID 45212407
5-[(2-chlorophenyl)methyl]-3-(cyclopropylmethyl)-5-[1-(3-methylbut-2-enyl)piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 45212407) has the molecular formula C24H32ClN3O2 and a molecular weight of 429.99 g/mol. Its IUPAC name is 5-[(2-chlorophenyl)methyl]-3-(cyclopropylmethyl)-5-[1-(3-methylbut-2-enyl)piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | 5-[(2-chlorophenyl)methyl]-3-(cyclopropylmethyl)-5-[1-(3-methylbut-2-enyl)piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45212407 |
| Molecular Formula | C24H32ClN3O2 |
| Molecular Weight | 429.99 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 5-[(2-chlorophenyl)methyl]-3-(cyclopropylmethyl)-5-[1-(3-methylbut-2-enyl)piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | CC(C)=CCN1CCC(C2(Cc3ccccc3Cl)NC(=O)N(CC3CC3)C2=O)CC1 |
| InChI | InChI=1S/C24H32ClN3O2/c1-17(2)9-12-27-13-10-20(11-14-27)24(15-19-5-3-4-6-21(19)25)22(29)28(23(30)26-24)16-18-7-8-18/h3-6,9,18,20H,7-8,10-16H2,1-2H3,(H,26,30) |
| InChIKey | MZQTYYPHDGMUOZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.99 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|