C27H32ClN3O4 — CID 45206652
5-[(2-chlorophenyl)methyl]-3-(2-methoxyethyl)-5-[1-(2-phenylpropanoyl)piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 45206652) has the molecular formula C27H32ClN3O4 and a molecular weight of 498.02 g/mol. Its IUPAC name is 5-[(2-chlorophenyl)methyl]-3-(2-methoxyethyl)-5-[1-(2-phenylpropanoyl)piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | 5-[(2-chlorophenyl)methyl]-3-(2-methoxyethyl)-5-[1-(2-phenylpropanoyl)piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45206652 |
| Molecular Formula | C27H32ClN3O4 |
| Molecular Weight | 498.02 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | 5-[(2-chlorophenyl)methyl]-3-(2-methoxyethyl)-5-[1-(2-phenylpropanoyl)piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | COCCN1C(=O)NC(Cc2ccccc2Cl)(C2CCN(C(=O)C(C)c3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C27H32ClN3O4/c1-19(20-8-4-3-5-9-20)24(32)30-14-12-22(13-15-30)27(18-21-10-6-7-11-23(21)28)25(33)31(16-17-35-2)26(34)29-27/h3-11,19,22H,12-18H2,1-2H3,(H,29,34) |
| InChIKey | SGILQPGHMKWOPG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.02 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|