C27H30FN3O4 — CID 45183370
5-[(3-fluorophenyl)methyl]-3-(2-methoxyethyl)-5-[1-[(E)-3-phenylprop-2-enoyl]piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 45183370) has the molecular formula C27H30FN3O4 and a molecular weight of 479.55 g/mol. Its IUPAC name is 5-[(3-fluorophenyl)methyl]-3-(2-methoxyethyl)-5-[1-[(E)-3-phenylprop-2-enoyl]piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | 5-[(3-fluorophenyl)methyl]-3-(2-methoxyethyl)-5-[1-[(E)-3-phenylprop-2-enoyl]piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45183370 |
| Molecular Formula | C27H30FN3O4 |
| Molecular Weight | 479.55 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | 5-[(3-fluorophenyl)methyl]-3-(2-methoxyethyl)-5-[1-[(E)-3-phenylprop-2-enoyl]piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | COCCN1C(=O)NC(Cc2cccc(F)c2)(C2CCN(C(=O)/C=C/c3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C27H30FN3O4/c1-35-17-16-31-25(33)27(29-26(31)34,19-21-8-5-9-23(28)18-21)22-12-14-30(15-13-22)24(32)11-10-20-6-3-2-4-7-20/h2-11,18,22H,12-17,19H2,1H3,(H,29,34)/b11-10+ |
| InChIKey | QSXKOERFOFMSOY-ZHACJKMWSA-N |
| XLogP | 3.26 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.55 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|