C27H29F2N3O4 — CID 26329509
(5S)-5-[(4-fluorophenyl)methyl]-5-[1-[(E)-3-(2-fluorophenyl)prop-2-enoyl]piperidin-4-yl]-3-(2-methoxyethyl)imidazolidine-2,4-dione (PubChem CID 26329509) has the molecular formula C27H29F2N3O4 and a molecular weight of 497.54 g/mol. Its IUPAC name is (5S)-5-[(4-fluorophenyl)methyl]-5-[1-[(E)-3-(2-fluorophenyl)prop-2-enoyl]piperidin-4-yl]-3-(2-methoxyethyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[(4-fluorophenyl)methyl]-5-[1-[(E)-3-(2-fluorophenyl)prop-2-enoyl]piperidin-4-yl]-3-(2-methoxyethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 26329509 |
| Molecular Formula | C27H29F2N3O4 |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | (5S)-5-[(4-fluorophenyl)methyl]-5-[1-[(E)-3-(2-fluorophenyl)prop-2-enoyl]piperidin-4-yl]-3-(2-methoxyethyl)imidazolidine-2,4-dione |
| SMILES | COCCN1C(=O)N[C@@](Cc2ccc(F)cc2)(C2CCN(C(=O)/C=C/c3ccccc3F)CC2)C1=O |
| InChI | InChI=1S/C27H29F2N3O4/c1-36-17-16-32-25(34)27(30-26(32)35,18-19-6-9-22(28)10-7-19)21-12-14-31(15-13-21)24(33)11-8-20-4-2-3-5-23(20)29/h2-11,21H,12-18H2,1H3,(H,30,35)/b11-8+/t27-/m0/s1 |
| InChIKey | PPIXUQDOHOOLPL-HSDHKRTLSA-N |
| XLogP | 3.40 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|