C26H34FN3O4 — CID 45209860
5-[1-[2-(cyclohexen-1-yl)acetyl]piperidin-4-yl]-5-[(4-fluorophenyl)methyl]-3-(2-methoxyethyl)imidazolidine-2,4-dione (PubChem CID 45209860) has the molecular formula C26H34FN3O4 and a molecular weight of 471.57 g/mol. Its IUPAC name is 5-[1-[2-(cyclohexen-1-yl)acetyl]piperidin-4-yl]-5-[(4-fluorophenyl)methyl]-3-(2-methoxyethyl)imidazolidine-2,4-dione.
| Compound Name | 5-[1-[2-(cyclohexen-1-yl)acetyl]piperidin-4-yl]-5-[(4-fluorophenyl)methyl]-3-(2-methoxyethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45209860 |
| Molecular Formula | C26H34FN3O4 |
| Molecular Weight | 471.57 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | 5-[1-[2-(cyclohexen-1-yl)acetyl]piperidin-4-yl]-5-[(4-fluorophenyl)methyl]-3-(2-methoxyethyl)imidazolidine-2,4-dione |
| SMILES | COCCN1C(=O)NC(Cc2ccc(F)cc2)(C2CCN(C(=O)CC3=CCCCC3)CC2)C1=O |
| InChI | InChI=1S/C26H34FN3O4/c1-34-16-15-30-24(32)26(28-25(30)33,18-20-7-9-22(27)10-8-20)21-11-13-29(14-12-21)23(31)17-19-5-3-2-4-6-19/h5,7-10,21H,2-4,6,11-18H2,1H3,(H,28,33) |
| InChIKey | UVOIWWDBJZWZDB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.57 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|