C18H24FN3O3 — CID 56707190
5-[(3-fluorophenyl)methyl]-3-(2-methoxyethyl)-5-piperidin-4-ylimidazolidine-2,4-dione (PubChem CID 56707190) has the molecular formula C18H24FN3O3 and a molecular weight of 349.41 g/mol. Its IUPAC name is 5-[(3-fluorophenyl)methyl]-3-(2-methoxyethyl)-5-piperidin-4-ylimidazolidine-2,4-dione.
| Compound Name | 5-[(3-fluorophenyl)methyl]-3-(2-methoxyethyl)-5-piperidin-4-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 56707190 |
| Molecular Formula | C18H24FN3O3 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 5-[(3-fluorophenyl)methyl]-3-(2-methoxyethyl)-5-piperidin-4-ylimidazolidine-2,4-dione |
| SMILES | COCCN1C(=O)NC(Cc2cccc(F)c2)(C2CCNCC2)C1=O |
| InChI | InChI=1S/C18H24FN3O3/c1-25-10-9-22-16(23)18(21-17(22)24,14-5-7-20-8-6-14)12-13-3-2-4-15(19)11-13/h2-4,11,14,20H,5-10,12H2,1H3,(H,21,24) |
| InChIKey | IJVLFSLKYOFAFM-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|