C20H24FN5O2 — CID 56723377
5-[(4-fluorophenyl)methyl]-3-[(1-methylimidazol-2-yl)methyl]-5-piperidin-4-ylimidazolidine-2,4-dione (PubChem CID 56723377) has the molecular formula C20H24FN5O2 and a molecular weight of 385.44 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)methyl]-3-[(1-methylimidazol-2-yl)methyl]-5-piperidin-4-ylimidazolidine-2,4-dione.
| Compound Name | 5-[(4-fluorophenyl)methyl]-3-[(1-methylimidazol-2-yl)methyl]-5-piperidin-4-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 56723377 |
| Molecular Formula | C20H24FN5O2 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 5-[(4-fluorophenyl)methyl]-3-[(1-methylimidazol-2-yl)methyl]-5-piperidin-4-ylimidazolidine-2,4-dione |
| SMILES | Cn1ccnc1CN1C(=O)NC(Cc2ccc(F)cc2)(C2CCNCC2)C1=O |
| InChI | InChI=1S/C20H24FN5O2/c1-25-11-10-23-17(25)13-26-18(27)20(24-19(26)28,15-6-8-22-9-7-15)12-14-2-4-16(21)5-3-14/h2-5,10-11,15,22H,6-9,12-13H2,1H3,(H,24,28) |
| InChIKey | HKRZYLCCTCEQQF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|