C20H21FN4O2 — CID 118759898
3-[(4-fluorophenyl)methyl]-5-piperidin-4-yl-5-pyridin-3-ylimidazolidine-2,4-dione (PubChem CID 118759898) has the molecular formula C20H21FN4O2 and a molecular weight of 368.41 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-5-piperidin-4-yl-5-pyridin-3-ylimidazolidine-2,4-dione.
| Compound Name | 3-[(4-fluorophenyl)methyl]-5-piperidin-4-yl-5-pyridin-3-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 118759898 |
| Molecular Formula | C20H21FN4O2 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-5-piperidin-4-yl-5-pyridin-3-ylimidazolidine-2,4-dione |
| SMILES | O=C1NC(c2cccnc2)(C2CCNCC2)C(=O)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C20H21FN4O2/c21-17-5-3-14(4-6-17)13-25-18(26)20(24-19(25)27,15-7-10-22-11-8-15)16-2-1-9-23-12-16/h1-6,9,12,15,22H,7-8,10-11,13H2,(H,24,27) |
| InChIKey | BDJSFSXKPSYJIC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|